| MolName | N,N'-bis[(Z)-(3-hydroxyphenyl)methylideneamino]pentanediamide |
| MolecularFormula | C19H20N4O4 |
| Smiles | Oc1cccc(/C=N\NC(CCCC(N/N=C\c2cc(O)ccc2)=O)=O)c1 |
| InChI | InChI=1S/C19H20N4O4/c24-16-6-1-4-14(10-16)12-20-22-18(26)8-3-9-19(27)23-21-13-15-5-2-7-17(25)11-15/h1-2,4-7,10-13,24-25H,3,8-9H2,(H,22,26)(H,23,27) |
| InChIK | DYIPYWSQCROVSJ-UHFFFAOYSA-N |
| TotalMolweight | 368.392 |
| Molweight | 368.392 |
| MonoisotopicMass | 368.148456 |
| CLogP | 3.2102 |
| CLogS | -4.336 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 294.94 |
| Relative PSA | 0.33302 |
| PolarSurfaceArea | 123.38 |
| Druglikeness | -1.2701 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 13 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(3-hydroxyphenyl)methylideneamino]pentanediamide | 2 - N,N'-bis[(Z)-(3-hydroxyphenyl)methylideneamino]pentanediamide