| MolName | N-[(Z)-(4-phenylphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
| MolecularFormula | C22H18N3OF3 |
| Smiles | O=C(CNc1cccc(C(F)(F)F)c1)N/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C22H18F3N3O/c23-22(24,25)19-7-4-8-20(13-19)26-15-21(29)28-27-14-16-9-11-18(12-10-16)17-5-2-1-3-6-17/h1-14,26H,15H2,(H,28,29) |
| InChIK | DYMXGKJXYNNWIW-UHFFFAOYSA-N |
| TotalMolweight | 397.399 |
| Molweight | 397.399 |
| MonoisotopicMass | 397.140196 |
| CLogP | 5.001 |
| CLogS | -6.407 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 301.43 |
| Relative PSA | 0.15748 |
| PolarSurfaceArea | 53.49 |
| Druglikeness | -2.1599 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-phenylphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide | 2 - N-[(Z)-(4-phenylphenyl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide