| MolName | 6-[(2Z)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| MolecularFormula | C14H10N5O3Cl |
| Smiles | O=C(C(N/N=C\c1ccc(-c(cc2)ccc2Cl)o1)=NN1)NC1=O |
| InChI | InChI=1S/C14H10ClN5O3/c15-9-3-1-8(2-4-9)11-6-5-10(23-11)7-16-18-12-13(21)17-14(22)20-19-12/h1-7H,(H,18,19)(H2,17,20,21,22) |
| InChIK | DYRFGROYMNMZMI-UHFFFAOYSA-N |
| TotalMolweight | 331.718 |
| Molweight | 331.718 |
| MonoisotopicMass | 331.047217 |
| CLogP | 1.8058 |
| CLogS | -5.365 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 242.24 |
| Relative PSA | 0.40286 |
| PolarSurfaceArea | 108.09 |
| Druglikeness | 7.4513 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-[(2Z)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione | 2 - 6-[(2Z)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione