| MolName | 1-carbamoyl-1-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-nitrophenyl)urea |
| MolecularFormula | C13H10N6O7 |
| Smiles | NC(N(C(Nc(cc1)ccc1[N+]([O-])=O)=O)/N=C\c1ccc([N+]([O-])=O)o1)=O |
| InChI | InChI=1S/C13H10N6O7/c14-12(20)17(15-7-10-5-6-11(26-10)19(24)25)13(21)16-8-1-3-9(4-2-8)18(22)23/h1-7H,(H2,14,20)(H,16,21) |
| InChIK | DYTXMYFIWXLNIZ-UHFFFAOYSA-N |
| TotalMolweight | 362.257 |
| Molweight | 362.257 |
| MonoisotopicMass | 362.061099 |
| CLogP | 0.3636 |
| CLogS | -5.404 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 260.59 |
| Relative PSA | 0.54806 |
| PolarSurfaceArea | 192.57 |
| Druglikeness | 3.5168 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-carbamoyl-1-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-nitrophenyl)urea | 2 - 1-carbamoyl-1-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-3-(4-nitrophenyl)urea