| MolName | 6-[2-(2-phenylethylimino)-3-[(Z)-quinolin-6-ylmethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| MolecularFormula | C29H23N5O2S |
| Smiles | O=C1Nc(cc(cc2)C(N3/N=C\c4cc5cccnc5cc4)=CS/C3=N\CCc3ccccc3)c2OC1 |
| InChI | InChI=1S/C29H23N5O2S/c35-28-18-36-27-11-9-23(16-25(27)33-28)26-19-37-29(31-14-12-20-5-2-1-3-6-20)34(26)32-17-21-8-10-24-22(15-21)7-4-13-30-24/h1-11,13,15-17,19H,12,14,18H2,(H,33,35) |
| InChIK | DYUQWIOWTBTNEJ-UHFFFAOYSA-N |
| TotalMolweight | 505.601 |
| Molweight | 505.601 |
| MonoisotopicMass | 505.157245 |
| CLogP | 5.0765 |
| CLogS | -6.819 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 379.86 |
| Relative PSA | 0.23569 |
| PolarSurfaceArea | 104.48 |
| Druglikeness | 5.2903 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-[2-(2-phenylethylimino)-3-[(Z)-quinolin-6-ylmethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one | 2 - 6-[2-(2-phenylethylimino)-3-[(Z)-quinolin-6-ylmethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one