| MolName | N-[(Z)-(2-fluorophenyl)methylideneamino]-4,6-diphenylpyrimidine-2-carboxamide |
| MolecularFormula | C24H17N4OF |
| Smiles | O=C(c1nc(-c2ccccc2)cc(-c2ccccc2)n1)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C24H17FN4O/c25-20-14-8-7-13-19(20)16-26-29-24(30)23-27-21(17-9-3-1-4-10-17)15-22(28-23)18-11-5-2-6-12-18/h1-16H,(H,29,30) |
| InChIK | DYUYKHDWSNKSPQ-UHFFFAOYSA-N |
| TotalMolweight | 396.424 |
| Molweight | 396.424 |
| MonoisotopicMass | 396.138639 |
| CLogP | 5.1291 |
| CLogS | -5.871 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 310.38 |
| Relative PSA | 0.18671 |
| PolarSurfaceArea | 67.24 |
| Druglikeness | 3.1287 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-fluorophenyl)methylideneamino]-4,6-diphenylpyrimidine-2-carboxamide | 2 - N-[(Z)-(2-fluorophenyl)methylideneamino]-4,6-diphenylpyrimidine-2-carboxamide