| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-thiophen-2-yl-N-[(Z)-thiophen-2-ylmethylideneamino]triazole-4-carboxamide |
| MolecularFormula | C14H10N8O2S2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccs2)=O)c1-c1cccs1 |
| InChI | InChI=1S/C14H10N8O2S2/c15-12-13(20-24-19-12)22-11(9-4-2-6-26-9)10(17-21-22)14(23)18-16-7-8-3-1-5-25-8/h1-7H,(H2,15,19)(H,18,23) |
| InChIK | DZCWNAMURCVSNJ-UHFFFAOYSA-N |
| TotalMolweight | 386.419 |
| Molweight | 386.419 |
| MonoisotopicMass | 386.036812 |
| CLogP | 3.3357 |
| CLogS | -3.137 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 280.84 |
| Relative PSA | 0.55854 |
| PolarSurfaceArea | 193.59 |
| Druglikeness | 3.506 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-thiophen-2-yl-N-[(Z)-thiophen-2-ylmethylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-thiophen-2-yl-N-[(Z)-thiophen-2-ylmethylideneamino]triazole-4-carboxamide