| MolName | [(Z)-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]methylideneamino]thiourea |
| MolecularFormula | C14H12N5ClS2 |
| Smiles | NC(N/N=C\c1cn(Cc(s2)cnc2Cl)c2c1cccc2)=S |
| InChI | InChI=1S/C14H12ClN5S2/c15-13-17-6-10(22-13)8-20-7-9(5-18-19-14(16)21)11-3-1-2-4-12(11)20/h1-7H,8H2,(H3,16,19,21) |
| InChIK | DZHGUJMNRAGOTE-UHFFFAOYSA-N |
| TotalMolweight | 349.869 |
| Molweight | 349.869 |
| MonoisotopicMass | 349.022262 |
| CLogP | 3.0747 |
| CLogS | -4.324 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 258.15 |
| Relative PSA | 0.40457 |
| PolarSurfaceArea | 128.56 |
| Druglikeness | 5.2483 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]methylideneamino]thiourea | 2 - [(Z)-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]methylideneamino]thiourea