| MolName | 1-[(Z)-(4-fluorophenyl)methylideneamino]-3-[4-[[(Z)-(4-fluorophenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea |
| MolecularFormula | C20H22N8F2S2 |
| Smiles | Fc1ccc(/C=N\NC(NN(CC2)CCN2NC(N/N=C\c(cc2)ccc2F)=S)=S)cc1 |
| InChI | InChI=1S/C20H22F2N8S2/c21-17-5-1-15(2-6-17)13-23-25-19(31)27-29-9-11-30(12-10-29)28-20(32)26-24-14-16-3-7-18(22)8-4-16/h1-8,13-14H,9-12H2,(H2,25,27,31)(H2,26,28,32) |
| InChIK | DZWJBBDABRAEDR-UHFFFAOYSA-N |
| TotalMolweight | 476.579 |
| Molweight | 476.579 |
| MonoisotopicMass | 476.137688 |
| CLogP | 1.8628 |
| CLogS | -5.482 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 368.64 |
| Relative PSA | 0.35796 |
| PolarSurfaceArea | 143.5 |
| Druglikeness | 3.6453 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-(4-fluorophenyl)methylideneamino]-3-[4-[[(Z)-(4-fluorophenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea | 2 - 1-[(Z)-(4-fluorophenyl)methylideneamino]-3-[4-[[(Z)-(4-fluorophenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea