| MolName | N-[5-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
| MolecularFormula | C16H12N6O5S |
| Smiles | [O-][N+](c(cc1)ccc1C(Nc1nnc(CC(N/N=C\c2ccco2)=O)s1)=O)=O |
| InChI | InChI=1S/C16H12N6O5S/c23-13(19-17-9-12-2-1-7-27-12)8-14-20-21-16(28-14)18-15(24)10-3-5-11(6-4-10)22(25)26/h1-7,9H,8H2,(H,19,23)(H,18,21,24) |
| InChIK | FAIWROMETSNNBT-UHFFFAOYSA-N |
| TotalMolweight | 400.374 |
| Molweight | 400.374 |
| MonoisotopicMass | 400.058989 |
| CLogP | 1.4573 |
| CLogS | -4.547 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 296.54 |
| Relative PSA | 0.49686 |
| PolarSurfaceArea | 183.54 |
| Druglikeness | 1.4299 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide | 2 - N-[5-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide