| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-4,6-diphenylpyrimidin-2-amine |
| MolecularFormula | C23H17N4Cl |
| Smiles | Clc1c(/C=N\Nc2nc(-c3ccccc3)cc(-c3ccccc3)n2)cccc1 |
| InChI | InChI=1S/C23H17ClN4/c24-20-14-8-7-13-19(20)16-25-28-23-26-21(17-9-3-1-4-10-17)15-22(27-23)18-11-5-2-6-12-18/h1-16H,(H,26,27,28) |
| InChIK | FAMKOSFTFQJIFQ-UHFFFAOYSA-N |
| TotalMolweight | 384.869 |
| Molweight | 384.869 |
| MonoisotopicMass | 384.114173 |
| CLogP | 7.7536 |
| CLogS | -6.708 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 301.7 |
| Relative PSA | 0.14886 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4,6-diphenylpyrimidin-2-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4,6-diphenylpyrimidin-2-amine