| MolName | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-(4-oxochromen-3-yl)methylideneamino]oxamide |
| MolecularFormula | C21H16N4O4S |
| Smiles | N#Cc1c(NC(C(N/N=C\C2=COc(cccc3)c3C2=O)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C21H16N4O4S/c22-9-15-13-5-2-4-8-17(13)30-21(15)24-19(27)20(28)25-23-10-12-11-29-16-7-3-1-6-14(16)18(12)26/h1,3,6-7,10-11H,2,4-5,8H2,(H,24,27)(H,25,28) |
| InChIK | FAQLPEQNORJKNZ-UHFFFAOYSA-N |
| TotalMolweight | 420.448 |
| Molweight | 420.448 |
| MonoisotopicMass | 420.089226 |
| CLogP | 2.3099 |
| CLogS | -6.1 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 314.35 |
| Relative PSA | 0.37369 |
| PolarSurfaceArea | 148.89 |
| Druglikeness | -4.1924 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-(4-oxochromen-3-yl)methylideneamino]oxamide | 2 - N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-(4-oxochromen-3-yl)methylideneamino]oxamide