| MolName | 2-nitro-N-[(Z)-thiophen-2-ylmethylideneamino]aniline |
| MolecularFormula | C11H9N3O2S |
| Smiles | [O-][N+](c(cccc1)c1N/N=C\c1cccs1)=O |
| InChI | InChI=1S/C11H9N3O2S/c15-14(16)11-6-2-1-5-10(11)13-12-8-9-4-3-7-17-9/h1-8,13H |
| InChIK | FARJTYMPQDVECZ-UHFFFAOYSA-N |
| TotalMolweight | 247.277 |
| Molweight | 247.277 |
| MonoisotopicMass | 247.041547 |
| CLogP | 3.7859 |
| CLogS | -3.619 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 188.85 |
| Relative PSA | 0.39052 |
| PolarSurfaceArea | 98.45 |
| Druglikeness | -1.1355 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-N-[(Z)-thiophen-2-ylmethylideneamino]aniline | 2 - 2-nitro-N-[(Z)-thiophen-2-ylmethylideneamino]aniline