| MolName | [2-[(Z)-(benzoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C21H15N2O3Cl |
| Smiles | O=C(c1ccccc1)N/N=C\c(cccc1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C21H15ClN2O3/c22-18-12-10-16(11-13-18)21(26)27-19-9-5-4-8-17(19)14-23-24-20(25)15-6-2-1-3-7-15/h1-14H,(H,24,25) |
| InChIK | FBKQFIHLZCIOFJ-UHFFFAOYSA-N |
| TotalMolweight | 378.814 |
| Molweight | 378.814 |
| MonoisotopicMass | 378.07712 |
| CLogP | 5.2381 |
| CLogS | -5.927 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 289.92 |
| Relative PSA | 0.20368 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 4.0416 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-(benzoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate | 2 - [2-[(Z)-(benzoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate