| MolName | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C19H20N4O3BrFS |
| Smiles | O=C(CN(CC1)CCN1S(c(cc1)ccc1Br)(=O)=O)N/N=C\c1cc(F)ccc1 |
| InChI | InChI=1S/C19H20BrFN4O3S/c20-16-4-6-18(7-5-16)29(27,28)25-10-8-24(9-11-25)14-19(26)23-22-13-15-2-1-3-17(21)12-15/h1-7,12-13H,8-11,14H2,(H,23,26) |
| InChIK | FBNWHLFOFLEOOZ-UHFFFAOYSA-N |
| TotalMolweight | 483.361 |
| Molweight | 483.361 |
| MonoisotopicMass | 482.04235 |
| CLogP | 2.8247 |
| CLogS | -3.339 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 316.45 |
| Relative PSA | 0.22654 |
| PolarSurfaceArea | 90.46 |
| Druglikeness | 4.1215 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide | 2 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide