| MolName | (3S)-N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| MolecularFormula | C18H16N2O5 |
| Smiles | O=C([C@H]1Oc(cccc2)c2OC1)N/N=C\c(cc1)cc2c1OCCO2 |
| InChI | InChI=1S/C18H16N2O5/c21-18(17-11-24-13-3-1-2-4-15(13)25-17)20-19-10-12-5-6-14-16(9-12)23-8-7-22-14/h1-6,9-10,17H,7-8,11H2,(H,20,21)/t17-/m0/s1 |
| InChIK | FBXLWFSKPKBYNW-KRWDZBQOSA-N |
| TotalMolweight | 340.334 |
| Molweight | 340.334 |
| MonoisotopicMass | 340.105923 |
| CLogP | 2.7225 |
| CLogS | -3.925 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 253.77 |
| Relative PSA | 0.29952 |
| PolarSurfaceArea | 78.38 |
| Druglikeness | -1.9594 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 1 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (3S)-N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide | 2 - (3S)-N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide