| MolName | N-[(Z)-[1-(cyanomethyl)indol-3-yl]methylideneamino]pyridine-2-carboxamide |
| MolecularFormula | C17H13N5O |
| Smiles | N#CCn1c(cccc2)c2c(/C=N\NC(c2ncccc2)=O)c1 |
| InChI | InChI=1S/C17H13N5O/c18-8-10-22-12-13(14-5-1-2-7-16(14)22)11-20-21-17(23)15-6-3-4-9-19-15/h1-7,9,11-12H,10H2,(H,21,23) |
| InChIK | FCFGGRURXYQTSL-UHFFFAOYSA-N |
| TotalMolweight | 303.324 |
| Molweight | 303.324 |
| MonoisotopicMass | 303.11201 |
| CLogP | 1.9285 |
| CLogS | -3.291 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 245.02 |
| Relative PSA | 0.27512 |
| PolarSurfaceArea | 83.07 |
| Druglikeness | 1.8717 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(cyanomethyl)indol-3-yl]methylideneamino]pyridine-2-carboxamide | 2 - N-[(Z)-[1-(cyanomethyl)indol-3-yl]methylideneamino]pyridine-2-carboxamide