| MolName | 2-(4-chlorophenyl)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H13N2O2Cl3 |
| Smiles | O=C(Cc(cc1)ccc1Cl)N/N=C\c1ccc(-c(cc2)cc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C19H13Cl3N2O2/c20-14-4-1-12(2-5-14)9-19(25)24-23-11-15-6-8-18(26-15)13-3-7-16(21)17(22)10-13/h1-8,10-11H,9H2,(H,24,25) |
| InChIK | FCFOLDQXYJVMIL-UHFFFAOYSA-N |
| TotalMolweight | 407.683 |
| Molweight | 407.683 |
| MonoisotopicMass | 406.004259 |
| CLogP | 5.9566 |
| CLogS | -7.354 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 296.46 |
| Relative PSA | 0.16906 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 6.4874 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenyl)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(4-chlorophenyl)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide