| MolName | (Z)-1-[5-(3,5-dinitrophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C13H8N6O5 |
| Smiles | c1cc(oc1C=Nn2cnnc2)c3cc(cc(c3)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C13H8N6O5/c20-18(21)10-3-9(4-11(5-10)19(22)23)13-2-1-12(24-13)6-16-17-7-14-15-8-17/h1-8H |
| InChIK | FCFOSPYQGNODQC-UHFFFAOYSA-N |
| TotalMolweight | 328.244 |
| Molweight | 328.244 |
| MonoisotopicMass | 328.055619 |
| CLogP | 0.324 |
| CLogS | -6.69 |
| H Acceptors | 11 |
| TotalSurfaceArea | 241.29 |
| Relative PSA | 0.47772 |
| PolarSurfaceArea | 147.85 |
| Druglikeness | 0.90369 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 7 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-(3,5-dinitrophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-(3,5-dinitrophenyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine