| MolName | 2-N,5-N-bis[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]furan-2,5-dicarboxamide |
| MolecularFormula | C22H14N6O11 |
| Smiles | [O-][N+](c1c(/C=N\NC(c2ccc(C(N/N=C\c(cc3OCOc3c3)c3[N+]([O-])=O)=O)o2)=O)cc2OCOc2c1)=O |
| InChI | InChI=1S/C22H14N6O11/c29-21(25-23-7-11-3-17-19(37-9-35-17)5-13(11)27(31)32)15-1-2-16(39-15)22(30)26-24-8-12-4-18-20(38-10-36-18)6-14(12)28(33)34/h1-8H,9-10H2,(H,25,29)(H,26,30) |
| InChIK | FCIBBIZRFXHUMF-UHFFFAOYSA-N |
| TotalMolweight | 538.384 |
| Molweight | 538.384 |
| MonoisotopicMass | 538.072059 |
| CLogP | 2.3659 |
| CLogS | -7.874 |
| H Acceptors | 17 |
| H Donors | 2 |
| TotalSurfaceArea | 378.27 |
| Relative PSA | 0.49428 |
| PolarSurfaceArea | 224.62 |
| Druglikeness | 0.4878 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 17 |
| Electronegative Atoms | 17 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 8 |
| Symmetricatoms | 19 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-N,5-N-bis[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]furan-2,5-dicarboxamide | 2 - 2-N,5-N-bis[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]furan-2,5-dicarboxamide