| MolName | 1-cyclohexyl-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]urea |
| MolecularFormula | C18H26N4O2 |
| Smiles | O=C(NC1CCCCC1)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H26N4O2/c23-18(20-16-4-2-1-3-5-16)21-19-14-15-6-8-17(9-7-15)22-10-12-24-13-11-22/h6-9,14,16H,1-5,10-13H2,(H2,20,21,23) |
| InChIK | FCPLMMTWULFROT-UHFFFAOYSA-N |
| TotalMolweight | 330.43 |
| Molweight | 330.43 |
| MonoisotopicMass | 330.205576 |
| CLogP | 2.7115 |
| CLogS | -4.407 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 268.33 |
| Relative PSA | 0.22741 |
| PolarSurfaceArea | 65.96 |
| Druglikeness | 0.63612 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-cyclohexyl-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]urea | 2 - 1-cyclohexyl-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]urea