| MolName | N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-iodobenzamide |
| MolecularFormula | C25H18N2O2BrI |
| Smiles | O=C(c(cccc1)c1I)N/N=C\c(c1ccccc1cc1)c1OCc1cc(Br)ccc1 |
| InChI | InChI=1S/C25H18BrIN2O2/c26-19-8-5-6-17(14-19)16-31-24-13-12-18-7-1-2-9-20(18)22(24)15-28-29-25(30)21-10-3-4-11-23(21)27/h1-15H,16H2,(H,29,30) |
| InChIK | FCTOQYPXTFXJMM-UHFFFAOYSA-N |
| TotalMolweight | 585.234 |
| Molweight | 585.234 |
| MonoisotopicMass | 583.959637 |
| CLogP | 6.9064 |
| CLogS | -8.518 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 350.02 |
| Relative PSA | 0.13145 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 2.686 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-iodobenzamide | 2 - N-[(Z)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-iodobenzamide