| MolName | 3-[4-[(Z)-[(3,4-dichlorophenyl)hydrazinylidene]methyl]-1-phenylpyrazol-3-yl]chromen-2-one |
| MolecularFormula | C25H16N4O2Cl2 |
| Smiles | O=C1Oc(cccc2)c2C=C1c(c(/C=N\Nc(cc1)cc(Cl)c1Cl)c1)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H16Cl2N4O2/c26-21-11-10-18(13-22(21)27)29-28-14-17-15-31(19-7-2-1-3-8-19)30-24(17)20-12-16-6-4-5-9-23(16)33-25(20)32/h1-15,29H |
| InChIK | FCTWSNBERIQYRT-UHFFFAOYSA-N |
| TotalMolweight | 475.334 |
| Molweight | 475.334 |
| MonoisotopicMass | 474.06503 |
| CLogP | 6.3687 |
| CLogS | -6.091 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 346.52 |
| Relative PSA | 0.18426 |
| PolarSurfaceArea | 68.51 |
| Druglikeness | 4.1719 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-[(Z)-[(3,4-dichlorophenyl)hydrazinylidene]methyl]-1-phenylpyrazol-3-yl]chromen-2-one | 2 - 3-[4-[(Z)-[(3,4-dichlorophenyl)hydrazinylidene]methyl]-1-phenylpyrazol-3-yl]chromen-2-one