| MolName | 2-[(Z)-(10-chloroanthracen-9-yl)methylideneamino]-1-hydroxyguanidine |
| MolecularFormula | C16H13N4OCl |
| Smiles | N/C(/NO)=N/N=C\c(c1ccccc11)c(cccc2)c2c1Cl |
| InChI | InChI=1S/C16H13ClN4O/c17-15-12-7-3-1-5-10(12)14(9-19-20-16(18)21-22)11-6-2-4-8-13(11)15/h1-9,22H,(H3,18,20,21) |
| InChIK | FCVGMMMRBFYCTL-UHFFFAOYSA-N |
| TotalMolweight | 312.759 |
| Molweight | 312.759 |
| MonoisotopicMass | 312.077788 |
| CLogP | 4.7515 |
| CLogS | -7.137 |
| H Acceptors | 5 |
| H Donors | 3 |
| TotalSurfaceArea | 231.94 |
| Relative PSA | 0.27098 |
| PolarSurfaceArea | 83 |
| Druglikeness | 1.8275 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(10-chloroanthracen-9-yl)methylideneamino]-1-hydroxyguanidine | 2 - 2-[(Z)-(10-chloroanthracen-9-yl)methylideneamino]-1-hydroxyguanidine