| MolName | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C18H14N3OClS2 |
| Smiles | O=C(CSc1nc(cccc2)c2s1)N/N=C\C(\Cl)=C\c1ccccc1 |
| InChI | InChI=1S/C18H14ClN3OS2/c19-14(10-13-6-2-1-3-7-13)11-20-22-17(23)12-24-18-21-15-8-4-5-9-16(15)25-18/h1-11H,12H2,(H,22,23) |
| InChIK | FDCVWROQIZCJQS-UHFFFAOYSA-N |
| TotalMolweight | 387.914 |
| Molweight | 387.914 |
| MonoisotopicMass | 387.026679 |
| CLogP | 4.3962 |
| CLogS | -6.082 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 287.67 |
| Relative PSA | 0.29489 |
| PolarSurfaceArea | 107.89 |
| Druglikeness | 5.0581 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]acetamide