| MolName | [2-[(Z)-[[1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| MolecularFormula | C27H17N4O3Cl3S |
| Smiles | O=C(c1nn(Cc(ccc(Cl)c2)c2Cl)cc1)N/N=C\c(cccc1)c1OC(c(sc1c2cccc1)c2Cl)=O |
| InChI | InChI=1S/C27H17Cl3N4O3S/c28-18-10-9-17(20(29)13-18)15-34-12-11-21(33-34)26(35)32-31-14-16-5-1-3-7-22(16)37-27(36)25-24(30)19-6-2-4-8-23(19)38-25/h1-14H,15H2,(H,32,35) |
| InChIK | FDPUMMSROKYNKW-UHFFFAOYSA-N |
| TotalMolweight | 583.882 |
| Molweight | 583.882 |
| MonoisotopicMass | 582.008692 |
| CLogP | 6.8451 |
| CLogS | -8.329 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 412.78 |
| Relative PSA | 0.2356 |
| PolarSurfaceArea | 113.82 |
| Druglikeness | 7.9429 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate | 2 - [2-[(Z)-[[1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate