| MolName | N-[(Z)-thiophen-2-ylmethylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| MolecularFormula | C16H12N2O3F6S |
| Smiles | O=C(c(cc(cc1)OCC(F)(F)F)c1OCC(F)(F)F)N/N=C\c1cccs1 |
| InChI | InChI=1S/C16H12F6N2O3S/c17-15(18,19)8-26-10-3-4-13(27-9-16(20,21)22)12(6-10)14(25)24-23-7-11-2-1-5-28-11/h1-7H,8-9H2,(H,24,25) |
| InChIK | FDQWXQJIONVIIZ-UHFFFAOYSA-N |
| TotalMolweight | 426.336 |
| Molweight | 426.336 |
| MonoisotopicMass | 426.047281 |
| CLogP | 4.7094 |
| CLogS | -5.847 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 289.37 |
| Relative PSA | 0.26392 |
| PolarSurfaceArea | 88.16 |
| Druglikeness | -1.0908 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-2-ylmethylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide | 2 - N-[(Z)-thiophen-2-ylmethylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide