| MolName | 2-(3-bromophenoxy)-N-[(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]acetamide |
| MolecularFormula | C25H25N3O3BrCl |
| Smiles | O=C(COc1cccc(Br)c1)N/N=C\C(CC/C1=C\c(cc2)ccc2Cl)=C1N1CCOCC1 |
| InChI | InChI=1S/C25H25BrClN3O3/c26-21-2-1-3-23(15-21)33-17-24(31)29-28-16-20-7-6-19(14-18-4-8-22(27)9-5-18)25(20)30-10-12-32-13-11-30/h1-5,8-9,14-16H,6-7,10-13,17H2,(H,29,31) |
| InChIK | FDRVSGNTBRLRIS-UHFFFAOYSA-N |
| TotalMolweight | 530.849 |
| Molweight | 530.849 |
| MonoisotopicMass | 529.07678 |
| CLogP | 4.6872 |
| CLogS | -5.637 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 368.29 |
| Relative PSA | 0.16172 |
| PolarSurfaceArea | 63.16 |
| Druglikeness | 3.0477 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3-bromophenoxy)-N-[(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]acetamide | 2 - 2-(3-bromophenoxy)-N-[(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]acetamide