| MolName | N-[(Z)-(3-chlorophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| MolecularFormula | C11H9N6O3Cl |
| Smiles | [O-][N+](c1nn(CC(N/N=C\c2cccc(Cl)c2)=O)cn1)=O |
| InChI | InChI=1S/C11H9ClN6O3/c12-9-3-1-2-8(4-9)5-14-15-10(19)6-17-7-13-11(16-17)18(20)21/h1-5,7H,6H2,(H,15,19) |
| InChIK | FDUZGVJRSXXKKC-UHFFFAOYSA-N |
| TotalMolweight | 308.684 |
| Molweight | 308.684 |
| MonoisotopicMass | 308.042466 |
| CLogP | 0.6887 |
| CLogS | -3.799 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 226.56 |
| Relative PSA | 0.42037 |
| PolarSurfaceArea | 117.99 |
| Druglikeness | 1.3696 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-chlorophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide | 2 - N-[(Z)-(3-chlorophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide