| MolName | N,N'-bis[(Z)-(3-hydroxyphenyl)methylideneamino]hexanediamide |
| MolecularFormula | C20H22N4O4 |
| Smiles | Oc1cccc(/C=N\NC(CCCCC(N/N=C\c2cc(O)ccc2)=O)=O)c1 |
| InChI | InChI=1S/C20H22N4O4/c25-17-7-3-5-15(11-17)13-21-23-19(27)9-1-2-10-20(28)24-22-14-16-6-4-8-18(26)12-16/h3-8,11-14,25-26H,1-2,9-10H2,(H,23,27)(H,24,28) |
| InChIK | FENXYARLMRIBSG-UHFFFAOYSA-N |
| TotalMolweight | 382.419 |
| Molweight | 382.419 |
| MonoisotopicMass | 382.164106 |
| CLogP | 3.6646 |
| CLogS | -4.606 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 308.7 |
| Relative PSA | 0.31817 |
| PolarSurfaceArea | 123.38 |
| Druglikeness | -4.1501 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(3-hydroxyphenyl)methylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-(3-hydroxyphenyl)methylideneamino]hexanediamide