| MolName | (Z)-1-(4-morpholin-4-ylsulfonylphenyl)-N-[(Z)-(4-morpholin-4-ylsulfonylphenyl)methylideneamino]methanimine |
| MolecularFormula | C22H26N4O6S2 |
| Smiles | O=S(c1ccc(/C=N\N=C/c(cc2)ccc2S(N2CCOCC2)(=O)=O)cc1)(N1CCOCC1)=O |
| InChI | InChI=1S/C22H26N4O6S2/c27-33(28,25-9-13-31-14-10-25)21-5-1-19(2-6-21)17-23-24-18-20-3-7-22(8-4-20)34(29,30)26-11-15-32-16-12-26/h1-8,17-18H,9-16H2 |
| InChIK | FEOQJTOBSPVASZ-UHFFFAOYSA-N |
| TotalMolweight | 506.602 |
| Molweight | 506.602 |
| MonoisotopicMass | 506.129376 |
| CLogP | 2.8712 |
| CLogS | -2.544 |
| H Acceptors | 10 |
| TotalSurfaceArea | 363.38 |
| Relative PSA | 0.29523 |
| PolarSurfaceArea | 134.7 |
| Druglikeness | 3.3827 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 12 |
| Symmetricatoms | 22 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-morpholin-4-ylsulfonylphenyl)-N-[(Z)-(4-morpholin-4-ylsulfonylphenyl)methylideneamino]methanimine | 2 - (Z)-1-(4-morpholin-4-ylsulfonylphenyl)-N-[(Z)-(4-morpholin-4-ylsulfonylphenyl)methylideneamino]methanimine