| MolName | N-[(Z)-furan-2-ylmethylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C12H10N4O |
| Smiles | C(c1ccco1)=N\Nc1nc(cccc2)c2[nH]1 |
| InChI | InChI=1S/C12H10N4O/c1-2-6-11-10(5-1)14-12(15-11)16-13-8-9-4-3-7-17-9/h1-8H,(H2,14,15,16) |
| InChIK | FEWRCTZTXATFKR-UHFFFAOYSA-N |
| TotalMolweight | 226.238 |
| Molweight | 226.238 |
| MonoisotopicMass | 226.085461 |
| CLogP | 3.9987 |
| CLogS | -3.313 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 181.86 |
| Relative PSA | 0.34114 |
| PolarSurfaceArea | 66.21 |
| Druglikeness | 2.7613 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-furan-2-ylmethylideneamino]-1H-benzimidazol-2-amine