| MolName | N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]thiophene-2-carboxamide |
| MolecularFormula | C14H10N2O3F4S |
| Smiles | O=C(c1cccs1)N/N=C\c(ccc(OC(F)F)c1)c1OC(F)F |
| InChI | InChI=1S/C14H10F4N2O3S/c15-13(16)22-9-4-3-8(10(6-9)23-14(17)18)7-19-20-12(21)11-2-1-5-24-11/h1-7,13-14H,(H,20,21) |
| InChIK | FEWUBOPCGJYBDN-UHFFFAOYSA-N |
| TotalMolweight | 362.302 |
| Molweight | 362.302 |
| MonoisotopicMass | 362.034825 |
| CLogP | 3.407 |
| CLogS | -4.975 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 253.33 |
| Relative PSA | 0.30146 |
| PolarSurfaceArea | 88.16 |
| Druglikeness | 3.2898 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]thiophene-2-carboxamide | 2 - N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]thiophene-2-carboxamide