| MolName | [(Z)-[2-(2-hydroxyphenyl)-2-oxoethylidene]amino]thiourea |
| MolecularFormula | C9H9N3O2S |
| Smiles | NC(N/N=C\C(c(cccc1)c1O)=O)=S |
| InChI | InChI=1S/C9H9N3O2S/c10-9(15)12-11-5-8(14)6-3-1-2-4-7(6)13/h1-5,13H,(H3,10,12,15) |
| InChIK | FFNNNWCLKJACJF-UHFFFAOYSA-N |
| TotalMolweight | 223.255 |
| Molweight | 223.255 |
| MonoisotopicMass | 223.041547 |
| CLogP | -0.0148 |
| CLogS | -2.67 |
| H Acceptors | 5 |
| H Donors | 3 |
| TotalSurfaceArea | 174.81 |
| Relative PSA | 0.52846 |
| PolarSurfaceArea | 119.8 |
| Druglikeness | 2.5724 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[2-(2-hydroxyphenyl)-2-oxoethylidene]amino]thiourea | 2 - [(Z)-[2-(2-hydroxyphenyl)-2-oxoethylidene]amino]thiourea