| MolName | 4-[(2Z)-2-[(2,6-difluorophenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| MolecularFormula | C13H10N4O4F2S |
| Smiles | NS(c(cc1)cc([N+]([O-])=O)c1N/N=C\c(c(F)ccc1)c1F)(=O)=O |
| InChI | InChI=1S/C13H10F2N4O4S/c14-10-2-1-3-11(15)9(10)7-17-18-12-5-4-8(24(16,22)23)6-13(12)19(20)21/h1-7,18H,(H2,16,22,23) |
| InChIK | FFOZILMKOKOBNR-UHFFFAOYSA-N |
| TotalMolweight | 356.308 |
| Molweight | 356.308 |
| MonoisotopicMass | 356.039082 |
| CLogP | 2.8849 |
| CLogS | -4.136 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 242.71 |
| Relative PSA | 0.40064 |
| PolarSurfaceArea | 138.75 |
| Druglikeness | -7.2435 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(2,6-difluorophenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide | 2 - 4-[(2Z)-2-[(2,6-difluorophenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide