| MolName | (2Z)-1-(2-chlorophenyl)-2-[(3-hydroxyphenyl)hydrazinylidene]ethanone |
| MolecularFormula | C14H11N2O2Cl |
| Smiles | Oc1cccc(N/N=C\C(c(cccc2)c2Cl)=O)c1 |
| InChI | InChI=1S/C14H11ClN2O2/c15-13-7-2-1-6-12(13)14(19)9-16-17-10-4-3-5-11(18)8-10/h1-9,17-18H |
| InChIK | FGAAPBNRYONHTD-UHFFFAOYSA-N |
| TotalMolweight | 274.706 |
| Molweight | 274.706 |
| MonoisotopicMass | 274.050905 |
| CLogP | 3.9001 |
| CLogS | -3.657 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 208.76 |
| Relative PSA | 0.23525 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 2.511 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-1-(2-chlorophenyl)-2-[(3-hydroxyphenyl)hydrazinylidene]ethanone | 2 - (2Z)-1-(2-chlorophenyl)-2-[(3-hydroxyphenyl)hydrazinylidene]ethanone