| MolName | 6-morpholin-4-yl-2-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C20H20N8O3 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nc(N3CCOCC3)nc(Nc3ccccc3)n2)cc1)=O |
| InChI | InChI=1S/C20H20N8O3/c29-28(30)17-8-6-15(7-9-17)14-21-26-19-23-18(22-16-4-2-1-3-5-16)24-20(25-19)27-10-12-31-13-11-27/h1-9,14H,10-13H2,(H2,22,23,24,25,26) |
| InChIK | FGBUUCBGRKTFIX-UHFFFAOYSA-N |
| TotalMolweight | 420.432 |
| Molweight | 420.432 |
| MonoisotopicMass | 420.165837 |
| CLogP | 4.0291 |
| CLogS | -5.476 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 322.25 |
| Relative PSA | 0.34542 |
| PolarSurfaceArea | 133.38 |
| Druglikeness | -1.7335 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-morpholin-4-yl-2-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4-diamine | 2 - 6-morpholin-4-yl-2-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4-diamine