| MolName | N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2,4-dinitroaniline |
| MolecularFormula | C15H15N5O5S |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\c1ccc(N2CCOCC2)s1)=O |
| InChI | InChI=1S/C15H15N5O5S/c21-19(22)11-1-3-13(14(9-11)20(23)24)17-16-10-12-2-4-15(26-12)18-5-7-25-8-6-18/h1-4,9-10,17H,5-8H2 |
| InChIK | FGSSBKVXSWDVAM-UHFFFAOYSA-N |
| TotalMolweight | 377.38 |
| Molweight | 377.38 |
| MonoisotopicMass | 377.07939 |
| CLogP | 2.7229 |
| CLogS | -4.332 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 274.36 |
| Relative PSA | 0.42907 |
| PolarSurfaceArea | 156.74 |
| Druglikeness | -0.50576 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2,4-dinitroaniline | 2 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2,4-dinitroaniline