| MolName | [4-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| MolecularFormula | C24H16N2O4Cl2S |
| Smiles | O=C(COc(cccc1)c1Cl)N/N=C\c(cc1)ccc1OC(c(sc1c2cccc1)c2Cl)=O |
| InChI | InChI=1S/C24H16Cl2N2O4S/c25-18-6-2-3-7-19(18)31-14-21(29)28-27-13-15-9-11-16(12-10-15)32-24(30)23-22(26)17-5-1-4-8-20(17)33-23/h1-13H,14H2,(H,28,29) |
| InChIK | FGYYCBLNXKXJLX-UHFFFAOYSA-N |
| TotalMolweight | 499.373 |
| Molweight | 499.373 |
| MonoisotopicMass | 498.020782 |
| CLogP | 6.3402 |
| CLogS | -7.792 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 359.64 |
| Relative PSA | 0.24861 |
| PolarSurfaceArea | 105.23 |
| Druglikeness | 5.3832 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate | 2 - [4-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate