| MolName | 2-[(E)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| MolecularFormula | C20H20N4O3S |
| Smiles | N#Cc1c(/N=C/c(cc2)cc([N+]([O-])=O)c2N2CCOCC2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H20N4O3S/c21-12-16-15-3-1-2-4-19(15)28-20(16)22-13-14-5-6-17(18(11-14)24(25)26)23-7-9-27-10-8-23/h5-6,11,13H,1-4,7-10H2 |
| InChIK | FISDKJDTRLRJGM-UHFFFAOYSA-N |
| TotalMolweight | 396.47 |
| Molweight | 396.47 |
| MonoisotopicMass | 396.125611 |
| CLogP | 2.8294 |
| CLogS | -5.746 |
| H Acceptors | 7 |
| TotalSurfaceArea | 302.48 |
| Relative PSA | 0.29556 |
| PolarSurfaceArea | 122.68 |
| Druglikeness | -11.126 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 11 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(E)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile | 2 - 2-[(E)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile