| MolName | 3-[(Z)-[(2,6-dimorpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| MolecularFormula | C19H24N6O3 |
| Smiles | Oc1cccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C19H24N6O3/c26-16-3-1-2-15(12-16)14-20-23-17-13-18(24-4-8-27-9-5-24)22-19(21-17)25-6-10-28-11-7-25/h1-3,12-14,26H,4-11H2,(H,21,22,23) |
| InChIK | FIURPTDRHKSEQS-UHFFFAOYSA-N |
| TotalMolweight | 384.439 |
| Molweight | 384.439 |
| MonoisotopicMass | 384.190989 |
| CLogP | 3.3423 |
| CLogS | -3.376 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 296.79 |
| Relative PSA | 0.28677 |
| PolarSurfaceArea | 95.34 |
| Druglikeness | 3.2651 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[(2,6-dimorpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]phenol | 2 - 3-[(Z)-[(2,6-dimorpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]phenol