| MolName | 2-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C24H20N8O4ClF |
| Smiles | [O-][N+](c(cc1)cc(-c2ccc(/C=N\Nc3nc(N4CCOCC4)nc(Nc(cc4)ccc4F)n3)o2)c1Cl)=O |
| InChI | InChI=1S/C24H20ClFN8O4/c25-20-7-5-17(34(35)36)13-19(20)21-8-6-18(38-21)14-27-32-23-29-22(28-16-3-1-15(26)2-4-16)30-24(31-23)33-9-11-37-12-10-33/h1-8,13-14H,9-12H2,(H2,28,29,30,31,32) |
| InChIK | FKMPSDXUNYIKSJ-UHFFFAOYSA-N |
| TotalMolweight | 538.926 |
| Molweight | 538.926 |
| MonoisotopicMass | 538.128007 |
| CLogP | 5.6748 |
| CLogS | -7.986 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 393.47 |
| Relative PSA | 0.31875 |
| PolarSurfaceArea | 146.52 |
| Druglikeness | -1.0967 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine