| MolName | N-[(Z)-benzylideneamino]pyrimidin-2-amine |
| MolecularFormula | C11H10N4 |
| Smiles | C(c1ccccc1)=N\Nc1ncccn1 |
| InChI | InChI=1S/C11H10N4/c1-2-5-10(6-3-1)9-14-15-11-12-7-4-8-13-11/h1-9H,(H,12,13,15) |
| InChIK | FKOZNHPIASHSHD-UHFFFAOYSA-N |
| TotalMolweight | 198.228 |
| Molweight | 198.228 |
| MonoisotopicMass | 198.090546 |
| CLogP | 3.6472 |
| CLogS | -2.416 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 166.76 |
| Relative PSA | 0.26931 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 2.4225 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.73333 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]pyrimidin-2-amine | 2 - N-[(Z)-benzylideneamino]pyrimidin-2-amine