| MolName | N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C23H15N2O3BrCl2 |
| Smiles | O=C(c1cc(cccc2)c2o1)N/N=C\c(cc(cc1)Br)c1OCc(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C23H15BrCl2N2O3/c24-17-6-8-20(30-13-15-5-7-18(25)11-19(15)26)16(9-17)12-27-28-23(29)22-10-14-3-1-2-4-21(14)31-22/h1-12H,13H2,(H,28,29) |
| InChIK | FKUBGFZDZSCDTH-UHFFFAOYSA-N |
| TotalMolweight | 518.193 |
| Molweight | 518.193 |
| MonoisotopicMass | 515.964308 |
| CLogP | 6.9925 |
| CLogS | -8.551 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 344.27 |
| Relative PSA | 0.17463 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 2.7352 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide | 2 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide