| MolName | 4-bromo-2-phenylmethoxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C19H15N2O2BrS |
| Smiles | O=C(c(ccc(Br)c1)c1OCc1ccccc1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C19H15BrN2O2S/c20-15-8-9-17(19(23)22-21-12-16-7-4-10-25-16)18(11-15)24-13-14-5-2-1-3-6-14/h1-12H,13H2,(H,22,23) |
| InChIK | FKXSUXIUCYZEAW-UHFFFAOYSA-N |
| TotalMolweight | 415.31 |
| Molweight | 415.31 |
| MonoisotopicMass | 414.003759 |
| CLogP | 5.1415 |
| CLogS | -5.906 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 285.08 |
| Relative PSA | 0.23281 |
| PolarSurfaceArea | 78.93 |
| Druglikeness | 3.8965 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-bromo-2-phenylmethoxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide | 2 - 4-bromo-2-phenylmethoxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide