| MolName | 4-chloro-2-nitro-6-[(Z)-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate |
| MolecularFormula | C19H10N4O4ClS |
| Smiles | [O-]c(c(/C=N\N(C=Nc1c2c(-c3ccccc3)cs1)C2=O)cc(Cl)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C19H11ClN4O4S/c20-13-6-12(17(25)15(7-13)24(27)28)8-22-23-10-21-18-16(19(23)26)14(9-29-18)11-4-2-1-3-5-11/h1-10,25H/p-1 |
| InChIK | FLRWJQQAWJEDGI-UHFFFAOYSA-M |
| TotalMolweight | 425.831 |
| Molweight | 425.831 |
| MonoisotopicMass | 425.011128 |
| CLogP | 1.8659 |
| CLogS | -6.835 |
| H Acceptors | 8 |
| TotalSurfaceArea | 299.41 |
| Relative PSA | 0.34959 |
| PolarSurfaceArea | 142.15 |
| Druglikeness | 0.64328 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-2-nitro-6-[(Z)-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate | 2 - 4-chloro-2-nitro-6-[(Z)-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate