| MolName | N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-5-phenyl-1,2,4-triazin-3-amine |
| MolecularFormula | C16H13N5O |
| Smiles | C(/C=N\Nc1nncc(-c2ccccc2)n1)=C/c1ccco1 |
| InChI | InChI=1S/C16H13N5O/c1-2-6-13(7-3-1)15-12-18-21-16(19-15)20-17-10-4-8-14-9-5-11-22-14/h1-12H,(H,19,20,21) |
| InChIK | FLTHRFGCZWSOHI-UHFFFAOYSA-N |
| TotalMolweight | 291.313 |
| Molweight | 291.313 |
| MonoisotopicMass | 291.11201 |
| CLogP | 3.7755 |
| CLogS | -3.717 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 241.47 |
| Relative PSA | 0.28985 |
| PolarSurfaceArea | 76.2 |
| Druglikeness | 1.8725 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-5-phenyl-1,2,4-triazin-3-amine | 2 - N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-5-phenyl-1,2,4-triazin-3-amine