| MolName | 2-(2-fluorophenyl)-N-[(Z)-(2-fluorophenyl)methylideneamino]quinazolin-4-amine |
| MolecularFormula | C21H14N4F2 |
| Smiles | Fc1c(/C=N\Nc2nc(-c(cccc3)c3F)nc3ccccc23)cccc1 |
| InChI | InChI=1S/C21H14F2N4/c22-17-10-4-1-7-14(17)13-24-27-21-16-9-3-6-12-19(16)25-20(26-21)15-8-2-5-11-18(15)23/h1-13H,(H,25,26,27) |
| InChIK | FLTILKWCGYIXHA-UHFFFAOYSA-N |
| TotalMolweight | 360.366 |
| Molweight | 360.366 |
| MonoisotopicMass | 360.118652 |
| CLogP | 6.7906 |
| CLogS | -6.944 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 273.82 |
| Relative PSA | 0.16401 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 1.0825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-fluorophenyl)-N-[(Z)-(2-fluorophenyl)methylideneamino]quinazolin-4-amine | 2 - 2-(2-fluorophenyl)-N-[(Z)-(2-fluorophenyl)methylideneamino]quinazolin-4-amine