| MolName | [4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| MolecularFormula | C25H19N4O4BrS |
| Smiles | N#Cc1c(NC(C(N/N=C\c(cc2)ccc2OC(c2cccc(Br)c2)=O)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C25H19BrN4O4S/c26-17-5-3-4-16(12-17)25(33)34-18-10-8-15(9-11-18)14-28-30-23(32)22(31)29-24-20(13-27)19-6-1-2-7-21(19)35-24/h3-5,8-12,14H,1-2,6-7H2,(H,29,31)(H,30,32) |
| InChIK | FMBIFUZHWRPHGF-UHFFFAOYSA-N |
| TotalMolweight | 551.42 |
| Molweight | 551.42 |
| MonoisotopicMass | 550.031037 |
| CLogP | 5.3482 |
| CLogS | -7.854 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 381.53 |
| Relative PSA | 0.30789 |
| PolarSurfaceArea | 148.89 |
| Druglikeness | -6.2696 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate | 2 - [4-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate