| MolName | 3-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C17H13N4O3ClS |
| Smiles | [O-][N+](c(cc1)cc(/C=N\N(C=Nc2c3c(CCCC4)c4s2)C3=O)c1Cl)=O |
| InChI | InChI=1S/C17H13ClN4O3S/c18-13-6-5-11(22(24)25)7-10(13)8-20-21-9-19-16-15(17(21)23)12-3-1-2-4-14(12)26-16/h5-9H,1-4H2 |
| InChIK | FMBMUTRNJDTKCV-UHFFFAOYSA-N |
| TotalMolweight | 388.834 |
| Molweight | 388.834 |
| MonoisotopicMass | 388.039688 |
| CLogP | 3.3694 |
| CLogS | -6.247 |
| H Acceptors | 7 |
| TotalSurfaceArea | 273.66 |
| Relative PSA | 0.3303 |
| PolarSurfaceArea | 119.09 |
| Druglikeness | -3.731 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one